On Target AA2BR_HUMAN 0.23350254/CHEMBL589251
For the given ligand CBDA, we have found in our database that, being scored 0.23350254, the most similar ligand is CHEMBL589251. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL589251 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CN1C(=O)N(C)c2nc([nH]c2C1=O)c3ccc(OCCOCCOCCOCCOCCCCCCCCCCC=C)cc3 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 0400802a 01801808 20180108 12010700 00081060 0000c000 02049200 00080440 16402100 901018e0 0c00800c 40008800 02809022 00d01000 012a0481 080e900c 00800000 0200a000 00402002 00420001 80000120 38000040 25802041 08700014 00040400 c0200000 60020000 80840020 00004205 00460c00 e4020800 40000280 |