On Target ADRB2_HUMAN 0.38686132/CHEMBL1082607
For the given ligand CBDA, we have found in our database that, being scored 0.38686132, the most similar ligand is CHEMBL1082607. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL1082607 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | OCc1cc(ccc1O)C(O)CNCCCCCCOCCCCc2ccccc2.OC(=O)c3ccc4ccccc4c3O |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000040 01000808 20100102 00010700 00081081 00024000 02000000 20000800 00000980 000808c0 a8300000 40018000 00008002 00a00000 00080000 00083008 10800000 02000000 00402000 40020201 00000120 18220a38 03000000 81500014 00000400 80000000 00520000 10000000 04000200 00060002 c0000000 00002600 |