On Target GASR_HUMAN 0.27118644/CHEMBL286847
For the given ligand CBDA, we have found in our database that, being scored 0.27118644, the most similar ligand is CHEMBL286847. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL286847 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | OC(=O)CC[C@H](NC(=O)CCC(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)N2CCC3(CCCC3)CC2)C(=O)NC4CCCc5ccccc45 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00038008 09803800 00100102 14010600 00180000 00000020 04000000 22001009 00300800 000b08c8 08300000 5003b800 060088b6 01202400 80000480 00080008 00000200 02000000 00402000 00000201 80020100 38068f30 01004001 0250001c 00002000 c0000001 00004000 90000000 08000102 01860803 a0064000 00822e00 |