On Target HRH2_HUMAN 0.32258064/CHEMBL490632
For the given ligand HU-580, we have found in our database that, being scored 0.32258064, the most similar ligand is CHEMBL490632. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL490632 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COc1c(OCCF)cccc1C(=O)C2CCN(CCc3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 06020000 43000808 2010010a 00210600 00001000 40020000 02000000 21000200 00100980 000808c0 08300000 50019840 0480c002 20200080 01004001 2208a008 00000000 02000000 00080400 00020201 00000100 18220200 00000000 81500414 00000000 c0000000 00000800 10000000 04000300 0006400a 80000000 00802600 |