On Target NPSR1_HUMAN 0.25641027/CHEMBL3086828
For the given ligand HU-580, we have found in our database that, being scored 0.25641027, the most similar ligand is CHEMBL3086828. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL3086828 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | O=C1c2ccccc2C(=O)C1(N3CCN(Cc4ccccc4)CC3)c5ccccc5 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 01000800 00100102 04010600 00000020 00008000 00000000 02001000 00000980 00090840 08300000 4000b000 07008802 00203001 40000400 00020000 00000200 02000000 00100008 00000201 00c00100 38328240 00404021 83400014 00000800 c0000001 00000000 80000000 0c000100 00060002 80046000 00000700 |