On Target CCR5_HUMAN 0.3586207/CHEMBL103268
For the given ligand HU-580, we have found in our database that, being scored 0.3586207, the most similar ligand is CHEMBL103268. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL103268 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | OC(=O)c1ccccc1CCCC2(O)CCN(C[C@H]3CN(CC4CCCCC4)C[C@@H]3c5ccccc5)CC2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 01000e00 00100102 00010600 00080000 0000c010 00000000 20000000 00200980 000809e0 08300000 50038800 00008002 00200000 00000020 000c0008 00000000 02000000 02c02000 00000201 00400500 18220a70 01004080 81500014 00000001 80000201 00000000 10000000 04000002 0006001a c0020000 00002600 |