On Target ADRB3_HUMAN 0.35849056/CHEMBL498519
For the given ligand HU-580, we have found in our database that, being scored 0.35849056, the most similar ligand is CHEMBL498519. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL498519 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | O[C@@H](CN[C@H]1CCc2ccc(Oc3ccc(cc3)C(=O)O)cc2C1)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00008000 57000a08 2010010b 00010600 000010a0 c0004000 06040000 20000001 00000980 000808c0 08300000 40808800 02008006 20200000 81080001 020c0008 10000200 02000000 00082000 00020201 00400100 18220b20 02004000 81480014 00002000 80000001 00520000 10200000 04000282 0006000a c0000400 00022600 |