On Target ADRB3_HUMAN 0.36551723/CHEMBL1201237
For the given ligand CBDA, we have found in our database that, being scored 0.36551723, the most similar ligand is CHEMBL1201237. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL1201237 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CC(C)(C)NC[C@H](O)COc1cccc2C(=O)CCCc12 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 04010000 43000808 2010010a 00010600 00001080 c2008000 02000000 00000201 00000810 00080840 08300000 40009040 04808002 20200080 01204001 20082008 10200200 22008000 00882000 00020201 00400100 18020240 07004080 08400414 00000001 c0000001 00000000 00800000 00000302 00064002 80000000 00400640 |