On Target CCR1_HUMAN 0.42753622/CHEMBL3138187
For the given ligand CBDA, we have found in our database that, being scored 0.42753622, the most similar ligand is CHEMBL3138187. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL3138187 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(c5)C(=O)O)c6cc(Cl)c(O)c(c6)C(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00008000 15000808 20000300 00010200 00000001 00024000 86200280 01000c00 00000100 00180a44 28000000 40008a00 02028006 00000000 80000402 08082008 00000400 02000000 02002000 40020001 00000000 08020b20 00008021 00400014 01002000 a0000800 00526000 c0000000 00404080 01220b02 e4020000 00020400 |