On Target TAAR1_HUMAN 0.33513513/CHEMBL3211097
For the given ligand HU-580, we have found in our database that, being scored 0.33513513, the most similar ligand is CHEMBL3211097. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL3211097 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CCOc1ccc(C\C(=N\CCc2ccccc2)\C3=C(O)CC(C)(C)CC3=O)cc1OCC |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04010002 43000808 2020010a 00310e00 00881000 40000000 12040080 10002402 010008a0 20188843 08130000 40009000 8482c022 20a02081 01000401 22188088 00000800 02000022 004d2000 00220241 00000101 38010280 41008802 81400810 00200000 a4020000 40524000 80400880 0c204212 0006000a 44020000 00410400 |