On Target TAAR1_HUMAN 0.34415585/CHEMBL1393484
For the given ligand CBDA, we have found in our database that, being scored 0.34415585, the most similar ligand is CHEMBL1393484. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL1393484 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CC(=C1C(=O)c2ccccc2C1=O)N3CCc4ccccc4C3 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00400008 01000800 00100102 10010600 00010060 00888000 00000021 02001400 81000d80 00980840 08300000 40409000 04008882 00201000 00000400 00020040 00010204 02100020 00130008 00000a01 00020100 18228640 0000c000 81400094 04000800 c0000000 00404000 80040500 04100100 00060202 a4040000 40000602 |