On Target DRD2_HUMAN 0.47407407/CHEMBL40634
For the given ligand HU-580, we have found in our database that, being scored 0.47407407, the most similar ligand is CHEMBL40634. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL40634 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CCCN(CCC)[C@@H]1CCc2cccc(C(=O)OC)c2[C@@H]1C |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 01000a00 00100102 00010600 00000021 0000c402 00000000 20000001 00000980 00080ac0 28300000 40808800 00008002 00210000 00000020 0a0c0008 00020200 02000000 00002000 40000201 00c00d00 18220a60 01004000 81400014 00000000 80002201 00000000 10000000 04000203 0006000a c0000004 00002600 |