On Target NK1R_HUMAN 0.33774835/CHEMBL22360
For the given ligand CBDA, we have found in our database that, being scored 0.33774835, the most similar ligand is CHEMBL22360. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL22360 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | COc1ccc(cc1CN[C@H]2CCCN[C@H]2c3ccccc3)C(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000000 01000808 2010010b 04010600 00001001 00000100 12040000 23001400 00200880 00190cc0 08300000 50038200 00008802 00202000 01000401 08082008 00000000 02000000 00002400 00020201 00000100 38228210 00000001 83400014 00000000 e0000000 08120000 d0000000 0c000382 00060002 a4040000 00000600 |