On Target OPRK_HUMAN 0.42682928/CHEMBL1773749
For the given ligand HU-580, we have found in our database that, being scored 0.42682928, the most similar ligand is CHEMBL1773749. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL1773749 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C4=CC5OC4c6ccccc56 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00050040 01000008 00000102 00010300 80380050 08804802 22001001 08000403 80000900 019a0840 48100000 4000d801 04028028 00a10000 00000420 02081008 00820010 82500300 33602010 00000801 00000520 18000a20 0100c040 00400014 00201400 80007601 00484000 80000020 00000202 0002000a 64020000 02800410 |