On Target CXCR3_HUMAN 0.33566433/CHEMBL2205063
For the given ligand CBDA, we have found in our database that, being scored 0.33566433, the most similar ligand is CHEMBL2205063. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL2205063 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | [I-].CC(=O)c1cccc(c1)c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00002010 01008800 00100100 00010600 00000001 00000000 00100000 22001402 00000100 001808c0 08200000 40018000 80028902 00010010 00000400 08080108 20020000 02001120 04002000 10000201 00000000 18028210 10008000 00500014 00200000 c0000080 00484200 90000041 10004100 00060002 a4260000 00000600 |