On Target ADA2B_HUMAN 0.31666666/CHEMBL1242950
For the given ligand CBDA, we have found in our database that, being scored 0.31666666, the most similar ligand is CHEMBL1242950. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL1242950 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CCCCC1CCN(CCCC(=O)c2ccccc2C)CC1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00020000 01000800 00100102 00010600 00000000 00008000 00000000 20000000 00100800 000808c0 08300000 50019000 04008002 00200000 00000020 00000000 00000000 02000000 00002000 00000201 00000100 18020210 00004000 00500014 00000000 80000001 00000000 10000000 00000000 00060002 80020000 00802600 |