On Target MSHR_HUMAN 0.26923078/CHEMBL1682208
For the given ligand HU-580, we have found in our database that, being scored 0.26923078, the most similar ligand is CHEMBL1682208. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL1682208 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COCC(=O)N[C@H]1Cc2cc3COCOc3c(Cc4ccc(Oc5cccc(CN(CCCN6CCN(CCCN)CC6)C1=O)c5)cc4)c2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 44803608 20100108 04010600 08001081 00004800 02040000 23001a0c 00200980 000909e0 6c300000 4000f210 06008802 00012002 01181401 022c2008 10000800 82000000 00082008 40020301 80440100 38288620 13000021 83448018 00000800 e0402000 00120000 f4a00001 0d000380 0006001b 62044404 00012608 |