On Target GRM5_HUMAN 0.39130434/CHEMBL1682818
For the given ligand HU-580, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL1682818. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL1682818 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | Cc1cccc(COc2ccc3C(=O)CCOc3c2)c1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04000001 00000818 20000109 00010300 00001001 02224000 42040000 00000200 00000900 00080840 08100000 40009060 10808002 00010000 11000001 02082008 00000000 02008004 00400000 40020801 00000100 08020220 01000060 00c01014 00000000 c0002000 00120800 00000000 00010300 00020002 c0000004 00000400 |