On Target NPBW1_HUMAN 0.24878049/CHEMBL1705448
For the given ligand CBDA, we have found in our database that, being scored 0.24878049, the most similar ligand is CHEMBL1705448. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL1705448 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | COc1ccc(OC2=C(Cl)C=NN(C2=O)c3ccc4CCCCc4c3)cc1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00010006 01000e08 6000010a 40050600 00081018 0000c008 42040002 01001001 06500900 800908c0 29102004 78858800 8600880a 02a00800 01000041 010d200c 00040200 0200002c 00202510 40260001 40420180 1c018328 20804880 83700010 04141000 80008801 08080000 00200000 04400202 0046000a c0040400 82e20680 |