On Target CLTR1_HUMAN 0.3846154/CHEMBL276879
For the given ligand HU-580, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL276879. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL276879 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | OC(=O)c1ccc(O)c(c1)C(=O)\C=C\c2cccc(OCc3ccc4ccccc4n3)c2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04000002 40000808 22024309 10010202 00041021 00824040 82800081 00000600 01840300 00b80a40 28000004 40108000 00808822 00410080 01020043 0a0c200c 04008400 02900000 00298000 40020a00 40000000 08028a28 a0808002 80c01114 01000000 80002000 00422040 40000000 00400204 00020102 c4040000 00000500 |