On Target 5HT1E_HUMAN 0.27071825/CHEMBL22744
For the given ligand CBDA, we have found in our database that, being scored 0.27071825, the most similar ligand is CHEMBL22744. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL22744 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | NC(=O)c1ccc2[nH]cc(C3=CCC(CC3)NCCCCCCCNC4CCC(=CC4)c5c[nH]c6ccc(cc56)C(=O)N)c2c1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000002 09008800 00100302 42810610 00041104 00000000 80082080 20001402 10500900 001828c8 08300004 41018800 88028802 00600800 00000442 00440004 00004400 02000064 00222400 00000203 41000100 1a068618 20808020 80500014 01042000 80000000 88406040 d0000000 04400002 00060c02 84060200 00002620 |