On Target 5HT2A_HUMAN 0.35897437/CHEMBL3104523
For the given ligand HU-580, we have found in our database that, being scored 0.35897437, the most similar ligand is CHEMBL3104523. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL3104523 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | Nc1ccc2CCC(CCN3CCC(CC3)C(=O)c4ccc(F)cc4O)C(O)c2c1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00020002 01000808 20100102 42010600 00180000 00024012 02000000 20000201 00500900 000888c0 08300004 50019840 04008002 00201800 00200060 00082008 00000200 02000080 00402000 80120201 40000500 18020230 21004000 00500014 00040000 80000201 00000000 10000001 00400002 0006c002 c0000000 00802e00 |