On Target ADA2C_HUMAN 0.32666665/CHEMBL14638
For the given ligand HU-580, we have found in our database that, being scored 0.32666665, the most similar ligand is CHEMBL14638. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL14638 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | O=C(C1CC1)c2ccc(OCCCc3c[nH]cn3)cc2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04000002 01000808 2000010b 00810310 04001040 02000000 02042000 00000000 00400900 00080840 28108000 40019800 04808002 01300800 11020001 000c200c 00000000 06000000 00400008 40020001 00000500 08020200 210000c0 00400014 00040001 82000200 00120000 00000000 00000204 00420002 c0000000 20000400 |