On Target DRD1_HUMAN 0.46835443/CHEMBL598730
For the given ligand HU-580, we have found in our database that, being scored 0.46835443, the most similar ligand is CHEMBL598730. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL598730 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COC(=O)c1cccc2[C@H]3[C@H](CCc12)N(C)CCc4cc(Cl)c(O)cc34 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00008000 47000a08 20100102 00010600 00001021 c000c402 06000400 21000001 04000980 00080ac0 28300000 40808a00 02008026 00210000 80000020 0a0c0008 00020200 02100000 00102000 40020201 00400500 18220b60 01004000 814a0014 00002000 a0002a01 00160000 50000000 06000283 0006000a c0000004 00022600 |