On Target NPFF1_HUMAN 0.22702703/CHEMBL2208334
For the given ligand HU-580, we have found in our database that, being scored 0.22702703, the most similar ligand is CHEMBL2208334. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL2208334 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COc1cccc(c1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(=O)N |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00018000 45003a08 20100108 04010e00 00001000 00000000 02000000 2200300c 00200a80 000908c2 08300000 4003b000 06009812 00002001 81004401 20100008 00000000 02000000 00080008 00020201 00000100 38278620 00000003 8354801c 00000800 c0000000 40000000 90000000 0c000310 0006000b a00c4000 00002600 |