On Target NPY1R_HUMAN 0.28368795/CHEMBL556915
For the given ligand CBDA, we have found in our database that, being scored 0.28368795, the most similar ligand is CHEMBL556915. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL556915 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | COc1ccc(cc1)[C@@H](C)N[C@@H]2CC[C@@H](C(=O)C3CCC(CC3)(NC(=O)C)c4ccccc4)C(C)(C)C2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00010000 01801008 2010010a 00010600 00001000 00000000 02040000 22001000 00000800 000808c0 08300000 40019000 0400881a 00200000 01000401 00000008 00000000 02000000 02002000 00020201 80000100 18048610 00000000 00500018 00000000 c0000000 00320000 90000000 00000302 00060003 20060000 00000600 |