On Target CCKAR_HUMAN 0.24596775/CHEMBL2372623
For the given ligand HU-580, we have found in our database that, being scored 0.24596775, the most similar ligand is CHEMBL2372623. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL2372623 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc3ccc4ccccc4c3)NC(=O)[C@H](Cc5cnc[nH]5)NC(=O)[C@@H]6Cc7ccccc7CN6C(=O)[C@@H](N)Cc8c(C)cc(O)cc8C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc9ccccc9)C(=O)N |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 0407800a 41803a08 20100100 55810e10 04141261 00000000 03002020 2200300c 00600b80 00090ac2 28308004 5003b800 1e00989a 00702801 810204c0 021c000c 00000200 0e000021 00e02418 40020201 e0020d00 38358e38 21804083 93500018 00043801 c0000201 48124000 90000100 0c000116 00c6000b e00c4200 20802e20 |