On Target OPRX_HUMAN 0.3464567/CHEMBL513585
For the given ligand CBDA, we have found in our database that, being scored 0.3464567, the most similar ligand is CHEMBL513585. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL513585 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | Cc1cccc2[C@@H](O)C[C@H](CN3CCC(CC3)c4ccccc4C)CCc12 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000000 01000200 00100102 00010600 00180001 00004002 00000000 20000001 00100900 000808c0 08300000 50018800 00000002 00a00000 00000020 020c0008 01000000 02000000 00402000 40000201 00000500 18000020 01004000 00500010 00000000 80000201 00000000 10000000 00000002 0006000a 40020000 00002e00 |