On Target GRM8_HUMAN 0.30708662/CHEMBL143210
For the given ligand CBDA, we have found in our database that, being scored 0.30708662, the most similar ligand is CHEMBL143210. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL143210 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | N[C@H](C(=O)O)c1ccc(C(=O)O)c(c1)C(=O)O |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000000 00000800 00000100 40050600 00000041 0000c000 00000000 00001000 00000100 00080e40 68000000 4000b800 81008800 00200000 40040000 08080008 08000000 02000000 00100000 40000000 00000000 08028b20 03000000 00400014 00000000 80000800 08000000 00004004 00000000 00060002 c0042000 00000400 |