On Target ACM2_HUMAN 0.36231884/CHEMBL3085495
For the given ligand HU-580, we have found in our database that, being scored 0.36231884, the most similar ligand is CHEMBL3085495. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL3085495 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | OC(CCN1CCCCC1)([C@H]2C[C@H]3C[C@@H]2C=C3)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 81000200 00100102 00010600 00080000 00004000 00000000 20000402 00000900 001808c8 08300000 50018000 00020002 00a00000 00000400 000c0008 00000000 02000020 00c02000 00002201 00000100 18000030 01008080 00500010 00200001 80202000 00404000 90000000 00000002 0106000a 64020000 00002600 |