On Target HRH4_HUMAN 0.33540374/CHEMBL4063170
For the given ligand HU-580, we have found in our database that, being scored 0.33540374, the most similar ligand is CHEMBL4063170. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL4063170 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | O=C(\C=C\c1ccccc1)c2ccc(OCCCc3c[nH]cn3)cc2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04000002 00000808 20000309 00810310 04001040 02800000 82042081 00000400 01c00900 00b80840 28008000 40018800 00808002 00100800 11020003 000c200c 00000400 06100000 00418008 40020801 00000400 08020200 210080c0 00400014 01040001 82000200 00522000 40000000 00400204 00420002 c4000000 20000400 |