On Target 5HT2C_HUMAN 0.37662336/CHEMBL542436
For the given ligand HU-580, we have found in our database that, being scored 0.37662336, the most similar ligand is CHEMBL542436. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL542436 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | Br.Cc1ccc2[C@H](CN)O[C@@H](Cc2c1O)C3CCCCC3 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 4b000008 20010502 80050700 00080071 80004002 02100000 00000241 00000900 00080848 08100000 40808940 00000002 00a10000 00041020 02083008 08800000 02000000 06402002 00020201 00010520 18000020 03004000 81400010 10000400 80002201 00080000 00000004 04000203 00064802 40020008 02000400 |