On Target GRM4_HUMAN 0.23626374/CHEMBL3901929
For the given ligand CBDA, we have found in our database that, being scored 0.23626374, the most similar ligand is CHEMBL3901929. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL3901929 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | Clc1cc(Nc2n[nH]c3cccnc23)ccc1C(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00008003 00010808 20005100 c0010220 000c0040 08000000 0e800010 01000200 00002100 10080840 88308004 40008810 02008826 00408001 00040040 000c400c 08040000 03001004 08600002 00264000 40080400 0c029b00 21800800 00600014 00122002 a0000200 2a040400 400000c0 00008088 00460002 c4040000 002244e0 |