On Target 5HT2B_HUMAN 0.32846716/CHEMBL3818056
For the given ligand CBDA, we have found in our database that, being scored 0.32846716, the most similar ligand is CHEMBL3818056. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL3818056 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | Oc1ccc(cc1)C(=O)CCCN2CCc3ccccc3C2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00020008 01000808 20100103 10010600 00000020 00000000 02000000 22001000 00100880 000808c0 08300000 40019000 04008882 00200000 00000400 00000008 00000200 02000020 00000000 00020201 00020100 18228200 00004000 81500014 00000000 c0000000 00124000 90000000 04000100 00060002 a0040000 00802600 |