On Target BKRB2_HUMAN 0.24019608/CHEMBL140383
For the given ligand HU-580, we have found in our database that, being scored 0.24019608, the most similar ligand is CHEMBL140383. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL140383 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CNC(=O)c1ccc(\C=C\C(=O)NCc2ccccc2c3ccc(C)c(COc4cccc5ccc(C)nc45)c3C)cc1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04002002 00808809 60004108 50010600 00041021 04004004 82900080 02221400 01800100 10400840 00200004 40048800 80808802 08610000 210204c3 020c200c 20020400 02001100 0c218000 50e20000 c1020000 08028628 30801020 80c0900c 00000400 c0082000 00486240 c0010041 00414305 00060001 c4040004 00000200 |