On Target CCR2_HUMAN 0.47540984/CHEMBL3754155
For the given ligand CBDA, we have found in our database that, being scored 0.47540984, the most similar ligand is CHEMBL3754155. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL3754155 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2cc(C)ccc2C |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00010000 01000000 00000102 00010200 00080001 00800000 01001081 08000402 81000900 00980840 08100000 40009000 04028028 00a00000 00000420 00080008 00000000 02100020 00612018 00000801 00000100 08000a80 0100c040 00400010 00201800 80000401 00404000 80000000 00000002 00020002 24020000 00000400 |