On Target 5HT1A_HUMAN 0.3857143/CHEMBL158210
For the given ligand HU-580, we have found in our database that, being scored 0.3857143, the most similar ligand is CHEMBL158210. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL158210 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | Oc1cccc2CC[C@@H](NCC=C)[C@@H](CC=C)c12 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00000000 43000208 20100102 00010600 00000020 40000002 02000000 20000601 10000880 001808c2 08300000 408080c0 00000002 00210000 00000400 02042008 80004200 02000100 00002000 00020201 00000100 18200000 00004000 81440010 00000000 80000001 04080000 90000000 04000002 0006400a 24020000 02010600 |