On Target MC5R_HUMAN 0.25142857/CHEMBL3913861
For the given ligand HU-580, we have found in our database that, being scored 0.25142857, the most similar ligand is CHEMBL3913861. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL3913861 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CC[C@H](CN1CC[C@H](CNC(=O)c2ccc3ccccc3c2OC)N[C@H](CCN4CCCCC4)C1=O)c5ccccc5 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00020000 01003c08 20100108 04010600 00001000 00020100 02000000 2200140c 00200880 001909e0 08300000 5003b000 06008802 00002001 81000401 00002008 00000000 02000000 00000000 00020201 08000100 382e8608 00000003 8350001c 00000000 c0000000 00000800 90000000 0c000300 00060013 a4044000 00802600 |