On Target V1AR_HUMAN 0.3372093/CHEMBL430676
For the given ligand Tetrahydrocannabinol, we have found in our database that, being scored 0.3372093, the most similar ligand is CHEMBL430676. Check out the elaboration below.
| Tetrahydrocannabinol (Given Ligand) | CHEMBL430676 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | COc1cccc(OC)c1C(=O)Nc2ccc(cc2)C(=O)N3CCC4(CCCC=C4)Cc5ccccc35 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00004003 01001808 2010011a 80110600 20001000 00022140 43000000 22001402 10100800 081808c2 08380024 4001c000 00028802 00308000 01020441 0000200a 0004c000 02000024 08002008 00020a01 40100100 18068610 2001a000 0054001c 00200000 c0000000 00400810 90001080 04088302 00060003 a4060080 20010600 |