On Target CCR5_HUMAN 0.32960895/CHEMBL2281967
For the given ligand Tetrahydrocannabinol, we have found in our database that, being scored 0.32960895, the most similar ligand is CHEMBL2281967. Check out the elaboration below.
| Tetrahydrocannabinol (Given Ligand) | CHEMBL2281967 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | Cc1cccc(C)c1NC(=O)NCC2(O)CCC(Cc3cc(Br)ccc3OCc4ccc(Cl)cc4)CC2 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 0400c016 1100d008 2010010a 00010e00 00081081 80004002 02000004 00002201 40000900 000808c0 08380004 c0018840 02809096 00b10000 01020041 02082008 20040000 02408020 0a402000 00020001 40000100 18050530 2302a000 00d01418 00116000 c0002000 00460010 10001080 00808302 00064003 400a0008 08024600 |