On Target OPRD_HUMAN 0.49112427/CHEMBL410907
For the given ligand Tetrahydrocannabinol, we have found in our database that, being scored 0.49112427, the most similar ligand is CHEMBL410907. Check out the elaboration below.
| Tetrahydrocannabinol (Given Ligand) | CHEMBL410907 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CN1CC[C@]23[C@@H]4CC=C[C@H]2[C@H]1Cc5ccc(O)c(O4)c35 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04001000 cb000208 20100d0a 80310700 00181061 c2000002 02080000 20000643 00000880 001818ca 08300300 51818040 00824002 20a00080 11040425 020ca018 08800200 22008060 04492000 0002a201 00000100 18200010 0100e000 81540410 00200000 c0002001 04524200 90000000 04000302 0006cc0a 24020000 00012e40 |