On Target CXCR2_HUMAN 0.40136054/CHEMBL3645131
For the given ligand Tetrahydrocannabinol, we have found in our database that, being scored 0.40136054, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| Tetrahydrocannabinol (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |