On Target MC5R_HUMAN 0.26060605/CHEMBL3913861
For the given ligand Tetrahydrocannabinol, we have found in our database that, being scored 0.26060605, the most similar ligand is CHEMBL3913861. Check out the elaboration below.
| Tetrahydrocannabinol (Given Ligand) | CHEMBL3913861 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CC[C@H](CN1CC[C@H](CNC(=O)c2ccc3ccccc3c2OC)N[C@H](CCN4CCCCC4)C1=O)c5ccccc5 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00020000 01003c08 20100108 04010600 00001000 00020100 02000000 2200140c 00200880 001909e0 08300000 5003b000 06008802 00002001 81000401 00002008 00000000 02000000 00000000 00020201 08000100 382e8608 00000003 8350001c 00000000 c0000000 00000800 90000000 0c000300 00060013 a4044000 00802600 |