On Target V1AR_HUMAN 0.5/CHEMBL1807258
For the given ligand fentanyl, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL1807258. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL1807258 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3.C | CN1CCC(CC1)NC(=O)[C@@H](Cc2ccc(Cl)cc2)NC(=O)Cc3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00008000 01003600 00100100 04010600 00000000 00000000 00000000 2000000c 00000880 000809e0 08300000 5001b800 07008026 00002000 c0000000 00040000 00000000 02000000 00000008 00000201 00000100 38280700 00000001 83500018 00002800 80000000 00040000 10000000 0c000000 0006001b 20006000 00022600 |