On Target ADA2A_HUMAN 0.42156863/CHEMBL395110
For the given ligand fentanyl, we have found in our database that, being scored 0.42156863, the most similar ligand is CHEMBL395110. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL395110 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3.C | CN1CCCC(CN2c3ccccc3Sc4ccccc24)C1 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00004002 01800600 00120000 00100600 20040000 00002000 00000010 00000000 00002000 000009e0 00204004 70018000 00000002 00000000 20020040 00000002 04041000 20000000 08200002 02000201 e0100000 18000020 20800000 00180019 00004000 00000100 02200010 10000080 00008200 01060010 0000a000 00012220 |