On Target ADA2C_HUMAN 0.52884614/CHEMBL279516
For the given ligand fentanyl, we have found in our database that, being scored 0.52884614, the most similar ligand is CHEMBL279516. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL279516 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3.C | O=C(NC1CCN(CCc2c[nH]c3ccccc23)CC1)c4ccccc4 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00000002 01001c00 00100100 41010610 00041000 00000000 00002000 22001000 00400080 000909e0 08200004 50018000 10008802 00400000 00000440 00040004 00000000 02000000 00200400 00000201 40000000 182a8608 20800000 9150001c 00042000 c0000000 08000000 90000000 04000100 00060013 a0040200 00002620 |