On Target ADRB2_HUMAN 0.04255319/CHEMBL275742
For the given ligand CCC, we have found in our database that, being scored 0.04255319, the most similar ligand is CHEMBL275742. Check out the elaboration below.
| CCC (Given Ligand) | CHEMBL275742 (Similar Ligand) |
|---|---|
| CCC | CC(C)NC[C@@H](O)COc1cccc2ccccc12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04000000 00000008 20100108 00010600 00001080 02000000 02000000 00000000 00000000 00000840 00200000 40008000 00800002 00000000 01200001 00082008 10200000 00000000 00800000 00020200 00000000 18000008 07000080 08000010 00000001 00000000 00000000 00800000 00000200 00060000 00000000 00000240 |