On Target HRH2_HUMAN 0.039215688/CHEMBL13795
For the given ligand CCC, we have found in our database that, being scored 0.039215688, the most similar ligand is CHEMBL13795. Check out the elaboration below.
| CCC (Given Ligand) | CHEMBL13795 (Similar Ligand) |
|---|---|
| CCC | N[C@H]1C[C@@H]1c2c[nH]cn2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00000000 00000000 01800410 04000240 00000000 00002000 00000000 00400900 00090280 20008000 40000800 00000000 01100800 00020000 000c0004 00000000 0e000000 00000008 40000001 20000c00 10000000 21000000 00000010 00040000 00000200 00000000 00000100 04000004 00460008 40000000 20000000 |