On Target CCR5_HUMAN 0.60115606/CHEMBL595902
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.60115606, the most similar ligand is CHEMBL595902. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL595902 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1cc(nc(C)c1C(=O)N2C[C@H]3CN(CCC4(CCN(C4)C(=O)C(C)(C)C)c5ccccc5)C[C@H]3C2)C#N |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10000002 01809e00 00104100 50010710 00041021 00008010 00004000 22001004 00200980 008809f0 09300004 40839000 80088802 00208000 00020480 0204000c 00424000 02000004 00a00000 00000201 c0020100 182c8e20 20800400 8150011c 00040000 c0000000 08004040 90001800 04400104 0006041b e0000040 80002620 |