On Target 5HT1E_HUMAN 0.35502958/CHEMBL4092027
For the given ligand CHEMBL1779871, we have found in our database that, being scored 0.35502958, the most similar ligand is CHEMBL4092027. Check out the elaboration below.
| CHEMBL1779871 (Given Ligand) | CHEMBL4092027 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1cc(CCNCc2ccc3c(C)cc(N)nc3c2)ccc1C#N |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00000002 00000800 00104100 00010600 00041025 00000000 00000000 02001000 00000180 00880840 08200004 40808800 80000802 00600000 00000440 000c000c 00400008 02000000 00a00000 00200200 40000000 1c208008 20800c80 81600010 00044000 c0000000 000000c0 80000000 04000108 00060402 20048000 00000620 |